[4-[(4-cyanobenzoyl)amino]phenyl]arsonic acid structure
|
Common Name | [4-[(4-cyanobenzoyl)amino]phenyl]arsonic acid | ||
|---|---|---|---|---|
| CAS Number | 5410-67-3 | Molecular Weight | 346.17000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11AsN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-[(4-cyanobenzoyl)amino]phenyl]arsonic acid |
|---|
| Molecular Formula | C14H11AsN2O4 |
|---|---|
| Molecular Weight | 346.17000 |
| Exact Mass | 345.99300 |
| PSA | 110.42000 |
| LogP | 0.44458 |
| InChIKey | RDLYRRAERMEDEK-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C(=O)Nc2ccc([As](=O)(O)O)cc2)cc1 |
|
~%
[4-[(4-cyanoben... CAS#:5410-67-3 |
| Literature: Doak; Steinman; Eagle Journal of the American Chemical Society, 1944 , vol. 66, p. 194,196 Journal of the American Chemical Society, 1945 , vol. 67, p. 719 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |