Benzamide,N-(4-acetylphenyl) structure
|
Common Name | Benzamide,N-(4-acetylphenyl) | ||
|---|---|---|---|---|
| CAS Number | 5411-13-2 | Molecular Weight | 239.26900 | |
| Density | 1.197g/cm3 | Boiling Point | 326.8ºC at 760mmHg | |
| Molecular Formula | C15H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.4ºC | |
| Name | N-(4-acetylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 326.8ºC at 760mmHg |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.26900 |
| Flash Point | 117.4ºC |
| Exact Mass | 239.09500 |
| PSA | 46.17000 |
| LogP | 3.21450 |
| InChIKey | ZJXQWYZBPKDYLS-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| N-benzoyl-4-aminoacetophenone |
| 4'-Acetylbenzanilide |
| 4'-benzamidoacetophenone |
| benzoic acid-(4-acetyl-anilide) |
| 4-Benzamino-acetophenon |
| Benzoesaeure-(4-acetyl-anilid) |
| benzamide,n-(4-acetylphenyl) |
| N-(4-ethanoylphenyl)benzamide |