tetrabromoterephthalic acid structure
|
Common Name | tetrabromoterephthalic acid | ||
|---|---|---|---|---|
| CAS Number | 5411-70-1 | Molecular Weight | 481.71500 | |
| Density | 2.687g/cm3 | Boiling Point | 491.8ºC at 760mmHg | |
| Molecular Formula | C8H2Br4O4 | Melting Point | ~350 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 251.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,3,5,6-tetrabromoterephthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.687g/cm3 |
|---|---|
| Boiling Point | 491.8ºC at 760mmHg |
| Melting Point | ~350 °C (dec.)(lit.) |
| Molecular Formula | C8H2Br4O4 |
| Molecular Weight | 481.71500 |
| Flash Point | 251.2ºC |
| Exact Mass | 477.66900 |
| PSA | 74.60000 |
| LogP | 4.13300 |
| Index of Refraction | 1.721 |
| InChIKey | PNXPXUDJXYVOFM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(Br)c(Br)c(C(=O)O)c(Br)c1Br |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2915900090 |
|
~%
tetrabromoterep... CAS#:5411-70-1 |
| Literature: Chemische Berichte, , vol. 29, p. 1633 |
|
~%
Detail
|
| Literature: Chemische Berichte, , vol. 29, p. 1633 |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Tetrabromoterephthalic acid |
| tetrabromo-1,4-benzenedicarboxylic acid |
| tetrabromoterepthalic acid |
| 2,3,5,6-tetrabromobenzene-1,4-dicarboxylic acid |
| MFCD00059637 |