Benzenamine,4-[(4-aminophenyl)sulfonyl]-2-chloro- structure
|
Common Name | Benzenamine,4-[(4-aminophenyl)sulfonyl]-2-chloro- | ||
|---|---|---|---|---|
| CAS Number | 5418-99-5 | Molecular Weight | 282.74600 | |
| Density | 1.455g/cm3 | Boiling Point | 524.7ºC at 760mmHg | |
| Molecular Formula | C12H11ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.1ºC | |
| Name | 4-(4-aminophenyl)sulfonyl-2-chloroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.455g/cm3 |
|---|---|
| Boiling Point | 524.7ºC at 760mmHg |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.74600 |
| Flash Point | 271.1ºC |
| Exact Mass | 282.02300 |
| PSA | 94.56000 |
| LogP | 4.58040 |
| Index of Refraction | 1.667 |
| InChIKey | RUARXDOHHXUAHU-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)c2ccc(N)c(Cl)c2)cc1 |
| HS Code | 2921590090 |
|---|
|
~%
Benzenamine,4-[... CAS#:5418-99-5 |
| Literature: Popoff; Engle; Whitaker; Singhal Journal of medicinal chemistry, 1971 , vol. 14, # 12 p. 1166 - 1169 |
|
~%
Benzenamine,4-[... CAS#:5418-99-5 |
| Literature: Popoff; Engle; Whitaker; Singhal Journal of medicinal chemistry, 1971 , vol. 14, # 12 p. 1166 - 1169 |
|
~%
Benzenamine,4-[... CAS#:5418-99-5 |
| Literature: Popoff; Engle; Whitaker; Singhal Journal of medicinal chemistry, 1971 , vol. 14, # 12 p. 1166 - 1169 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-[(4-Amino-3-chlorophenyl)sulfonyl]phenylamine |
| 4-Aminophenyl-4-amio-3-chlorphenylsulfon |