N-[4-(4-bromophenoxy)but-2-ynyl]-N-ethyl-aniline structure
|
Common Name | N-[4-(4-bromophenoxy)but-2-ynyl]-N-ethyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 54186-04-8 | Molecular Weight | 344.24600 | |
| Density | 1.317g/cm3 | Boiling Point | 461ºC at 760 mmHg | |
| Molecular Formula | C18H18BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.6ºC | |
| Name | N-[4-(4-bromophenoxy)but-2-ynyl]-N-ethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 461ºC at 760 mmHg |
| Molecular Formula | C18H18BrNO |
| Molecular Weight | 344.24600 |
| Flash Point | 232.6ºC |
| Exact Mass | 343.05700 |
| PSA | 12.47000 |
| LogP | 4.35780 |
| Index of Refraction | 1.613 |
| InChIKey | VCMWGGRQLWBCLQ-UHFFFAOYSA-N |
| SMILES | CCN(CC#CCOc1ccc(Br)cc1)c1ccccc1 |
|
~%
N-[4-(4-bromoph... CAS#:54186-04-8 |
| Literature: Hillard,J. et al. Journal of Heterocyclic Chemistry, 1974 , vol. 11, p. 369 - 375 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-[4-(4-bromophenoxy)but-2-yn-1-yl]-N-ethylaniline |