N-[4-(4-bromophenoxy)but-2-ynyl]-N-methyl-aniline structure
|
Common Name | N-[4-(4-bromophenoxy)but-2-ynyl]-N-methyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 54186-03-7 | Molecular Weight | 330.21900 | |
| Density | 1.348g/cm3 | Boiling Point | 449.9ºC at 760 mmHg | |
| Molecular Formula | C17H16BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.9ºC | |
| Name | N-[4-(4-bromophenoxy)but-2-ynyl]-N-methylaniline |
|---|
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 449.9ºC at 760 mmHg |
| Molecular Formula | C17H16BrNO |
| Molecular Weight | 330.21900 |
| Flash Point | 225.9ºC |
| Exact Mass | 329.04200 |
| PSA | 12.47000 |
| LogP | 3.96770 |
| Index of Refraction | 1.623 |
| InChIKey | HPSWSKADYGEXJO-UHFFFAOYSA-N |
| SMILES | CN(CC#CCOc1ccc(Br)cc1)c1ccccc1 |
|
~%
N-[4-(4-bromoph... CAS#:54186-03-7 |
| Literature: Hillard,J. et al. Journal of Heterocyclic Chemistry, 1974 , vol. 11, p. 369 - 375 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |