2-[6-[2-(3,4-dihydroxyphenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol structure
|
Common Name | 2-[6-[2-(3,4-dihydroxyphenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol | ||
|---|---|---|---|---|
| CAS Number | 54241-03-1 | Molecular Weight | 403.38900 | |
| Density | 1.74g/cm3 | Boiling Point | 835.1ºC at 760 mmHg | |
| Molecular Formula | C18H21N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 458.9ºC | |
| Name | 2-[6-[2-(3,4-dihydroxyphenyl)ethylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|
| Density | 1.74g/cm3 |
|---|---|
| Boiling Point | 835.1ºC at 760 mmHg |
| Molecular Formula | C18H21N5O6 |
| Molecular Weight | 403.38900 |
| Flash Point | 458.9ºC |
| Exact Mass | 403.14900 |
| PSA | 166.01000 |
| Index of Refraction | 1.783 |
| InChIKey | LJSCNWRFGRIEQT-UHFFFAOYSA-N |
| SMILES | OCC1OC(n2cnc3c(NCCc4ccc(O)c(O)c4)ncnc32)C(O)C1O |
|
~%
2-[6-[2-(3,4-di... CAS#:54241-03-1 |
| Literature: INSTITUTE OF MATERIA MEDICA, CHINESE ACADEMY OF MEDICAL SCIENCES Patent: EP2511283 A1, 2012 ; Location in patent: Page/Page column 59 ; |
|
~%
2-[6-[2-(3,4-di... CAS#:54241-03-1 |
| Literature: Bressi; Choe; HoughHough; Buckner; Van Voorhis; Verlinde; Hol; Gelb Journal of Medicinal Chemistry, 2000 , vol. 43, # 22 p. 4135 - 4150 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |