3H-Pyrazol-3-one,4-bromo-1,2-dihydro-1,5-dimethyl-2-phenyl- structure
|
Common Name | 3H-Pyrazol-3-one,4-bromo-1,2-dihydro-1,5-dimethyl-2-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5426-65-3 | Molecular Weight | 267.12200 | |
| Density | 1.525g/cm3 | Boiling Point | 309.3ºC at 760mmHg | |
| Molecular Formula | C11H11BrN2O | Melting Point | 117ºC | |
| MSDS | N/A | Flash Point | 140.8ºC | |
| Name | 4-bromoantipyrine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.525g/cm3 |
|---|---|
| Boiling Point | 309.3ºC at 760mmHg |
| Melting Point | 117ºC |
| Molecular Formula | C11H11BrN2O |
| Molecular Weight | 267.12200 |
| Flash Point | 140.8ºC |
| Exact Mass | 266.00500 |
| PSA | 26.93000 |
| LogP | 2.24690 |
| Index of Refraction | 1.63 |
| InChIKey | QYWWSDVPNCBSIA-UHFFFAOYSA-N |
| SMILES | Cc1c(Br)c(=O)n(-c2ccccc2)n1C |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933199090 |
|
~75%
3H-Pyrazol-3-on... CAS#:5426-65-3 |
| Literature: Krohn; Stenns Archiv der Pharmazie, 1989 , vol. 322, # 6 p. 351 - 354 |
|
~%
3H-Pyrazol-3-on... CAS#:5426-65-3 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 434, p. 310 |
|
~%
3H-Pyrazol-3-on... CAS#:5426-65-3 |
| Literature: Bulletin des Societes Chimiques Belges, , vol. 61, p. 331,344 |
|
~%
3H-Pyrazol-3-on... CAS#:5426-65-3 |
| Literature: Bulletin des Societes Chimiques Belges, , vol. 61, p. 331,344 |
|
~%
3H-Pyrazol-3-on... CAS#:5426-65-3 |
| Literature: Bulletin des Societes Chimiques Belges, , vol. 61, p. 331,344 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Brom-1,5-dimethyl-2-phenyl-1,2-dihydro-pyrazol-3-on |
| 4-Bromphenazon |
| 4-bromo-1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one |
| 4-bromo-1,5-dimethyl-2-phenyl-pyrazol-3-one |
| 4-bromo-1,5-dimethyl-2-phenyl-1,2-dihydro-pyrazol-3-one |
| 4-bromo-1,5-dimethyl-2-phenyl-1,2-dihydro-3H-pyrazol-3-one |
| Bromoantipyrine |