N-(2-methoxy-4-nitro-phenyl)-4-nitro-benzamide structure
|
Common Name | N-(2-methoxy-4-nitro-phenyl)-4-nitro-benzamide | ||
|---|---|---|---|---|
| CAS Number | 5428-51-3 | Molecular Weight | 317.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-methoxy-4-nitrophenyl)-4-nitrobenzamide |
|---|
| Molecular Formula | C14H11N3O6 |
|---|---|
| Molecular Weight | 317.25400 |
| Exact Mass | 317.06500 |
| PSA | 129.97000 |
| LogP | 3.88330 |
| InChIKey | CENHPWNADSTTBN-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
|
~84%
N-(2-methoxy-4-... CAS#:5428-51-3 |
| Literature: Shridhar, D. R.; Rao, K. Srinivasa; Singh, A. N.; Rastogi, K.; Jain, M. L. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 1277 - 1280 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |