N-(2-methoxy-4-nitro-phenyl)butanamide structure
|
Common Name | N-(2-methoxy-4-nitro-phenyl)butanamide | ||
|---|---|---|---|---|
| CAS Number | 78701-56-1 | Molecular Weight | 238.24000 | |
| Density | 1.244g/cm3 | Boiling Point | 424.3ºC at 760mmHg | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.4ºC | |
| Name | Thymylbutyrat |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 424.3ºC at 760mmHg |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24000 |
| Flash Point | 210.4ºC |
| Exact Mass | 238.09500 |
| PSA | 84.15000 |
| LogP | 2.93820 |
| InChIKey | QYTAXIIQSIQLGK-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Nc1ccc([N+](=O)[O-])cc1OC |
| HS Code | 2924299090 |
|---|
|
~92%
N-(2-methoxy-4-... CAS#:78701-56-1 |
| Literature: H. LUNDBECK A/S Patent: WO2004/82677 A1, 2004 ; Location in patent: Page/Page column 97-98 ; |
|
~%
N-(2-methoxy-4-... CAS#:78701-56-1 |
| Literature: Wu; Herbst Journal of Organic Chemistry, 1952 , vol. 17, p. 1216,1221 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-butyrylamino-3-methoxy-nitrobenzene |
| Buttersaeure-thymylester |
| 3-Butyryloxy-p-cymol |