1-morpholin-4-yl-2-(4-phenylphenyl)ethanethione structure
|
Common Name | 1-morpholin-4-yl-2-(4-phenylphenyl)ethanethione | ||
|---|---|---|---|---|
| CAS Number | 5428-57-9 | Molecular Weight | 297.41500 | |
| Density | 1.172g/cm3 | Boiling Point | 462.4ºC at 760 mmHg | |
| Molecular Formula | C18H19NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.4ºC | |
| Name | 1-morpholin-4-yl-2-(4-phenylphenyl)ethanethione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 462.4ºC at 760 mmHg |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.41500 |
| Flash Point | 233.4ºC |
| Exact Mass | 297.11900 |
| PSA | 44.56000 |
| LogP | 3.49360 |
| Index of Refraction | 1.62 |
| InChIKey | JTXKUELKOQEINN-UHFFFAOYSA-N |
| SMILES | S=C(Cc1ccc(-c2ccccc2)cc1)N1CCOCC1 |
|
~95%
1-morpholin-4-y... CAS#:5428-57-9 |
| Literature: Matloubi Moghaddam; Ghaffarzadeh Synthetic Communications, 2001 , vol. 31, # 2 p. 317 - 321 |
|
~72%
1-morpholin-4-y... CAS#:5428-57-9 |
| Literature: Moghaddam, Firouz Matloubi; Ghaffarzadeh, Mohammad; Dakamin, Mohammad G. Journal of Chemical Research - Part S, 2000 , # 5 p. 228 - 229 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| 4-biphenyl-4-ylsulfanylacetyl-morpholine |
| 4-(biphenyl-4-yl-thioacetyl)-morpholine |
| 4-(4-Biphenylylthioacetyl)morpholin |
| 2-biphenyl-4-yl-1-morpholin-4-yl-ethanethione |
| 4-Biphenyl-4-ylthioacetyl-morpholin |
| 4-Biphenylyl-thioacetmorpholid |
| 4-(2-[1,1'-biphenyl]-4-ylethanethioyl)morpholine |
| biphenylthioacetylmorpholide |