Benzenesulfonamide,4-(1H-pyrrol-1-yl)-
Modify Date: 2025-09-23 15:22:41
Benzenesulfonamide,4-(1H-pyrrol-1-yl)- structure
|
Common Name | Benzenesulfonamide,4-(1H-pyrrol-1-yl)- | ||
|---|---|---|---|---|
| CAS Number | 5438-30-2 | Molecular Weight | 222.26400 | |
| Density | 1.35g/cm3 | Boiling Point | 410ºC at 760 mmHg | |
| Molecular Formula | C10H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.8ºC | |
| Name | 4-pyrrol-1-ylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 410ºC at 760 mmHg |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.26400 |
| Flash Point | 201.8ºC |
| Exact Mass | 222.04600 |
| PSA | 73.47000 |
| LogP | 2.90580 |
| Index of Refraction | 1.638 |
| InChIKey | HEROWGICZZJWKP-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(-n2cccc2)cc1 |
| HS Code | 2935009090 |
|---|
|
~74%
Benzenesulfonam... CAS#:5438-30-2 |
| Literature: Llobet, Antoni; Masllorens, Ester; Rodriguez, Montserrat; Roglans, Anna; Benet-Buchholz, Jordi European Journal of Inorganic Chemistry, 2004 , # 8 p. 1601 - 1610 |
|
~%
Benzenesulfonam... CAS#:5438-30-2 |
| Literature: Mehltretter Journal of the American Chemical Society, 1947 , vol. 69, p. 2133 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 4-pyrrol-1-yl-benzenesulfonic acid amide |
| 4-Pyrrol-1-yl-benzolsulfonsaeure-amid |
| (4-pyrrol-1-ylphenyl)sulfonamide |
| 4-(1h-pyrrol-1-yl)benzenesulfonamide |