(2-methyl-4-nitro-hexan-3-yl) acetate structure
|
Common Name | (2-methyl-4-nitro-hexan-3-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 5440-66-4 | Molecular Weight | 203.23600 | |
| Density | 1.045g/cm3 | Boiling Point | 244.3ºC at 760 mmHg | |
| Molecular Formula | C9H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 83.7ºC | |
| Name | (2-methyl-4-nitrohexan-3-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.045g/cm3 |
|---|---|
| Boiling Point | 244.3ºC at 760 mmHg |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.23600 |
| Flash Point | 83.7ºC |
| Exact Mass | 203.11600 |
| PSA | 72.12000 |
| LogP | 2.15260 |
| Index of Refraction | 1.441 |
| InChIKey | GNTZENDEEVYVID-UHFFFAOYSA-N |
| SMILES | CCC(C(OC(C)=O)C(C)C)[N+](=O)[O-] |
|
~%
(2-methyl-4-nit... CAS#:5440-66-4 |
| Literature: Nightingale; Janes Journal of the American Chemical Society, 1944 , vol. 66, p. 353 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-methyl-4-nitrohexan-3-yl acetate |