Butanoicacid, 3-methyl-3-(4-methylphenyl)- structure
|
Common Name | Butanoicacid, 3-methyl-3-(4-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5440-72-2 | Molecular Weight | 250.29000 | |
| Density | 1.183g/cm3 | Boiling Point | 362.7ºC at 760mmHg | |
| Molecular Formula | C14H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.3ºC | |
| Name | 3-methyl-3-(4-methylphenyl)-Butanoicacid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 362.7ºC at 760mmHg |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29000 |
| Flash Point | 187.3ºC |
| Exact Mass | 250.12100 |
| PSA | 74.60000 |
| LogP | 2.44810 |
| Index of Refraction | 1.54 |
| InChIKey | AUYJZZFEHKGYHT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)(C)C(CC(=O)O)C(=O)O)cc1 |
|
~%
Butanoicacid, 3... CAS#:5440-72-2 |
| Literature: Bickford et al. Journal of the American Oil Chemists' Society, 1948 , vol. 25, p. 251,252 Full Text Show Details Shechter; Barker Journal of Organic Chemistry, 1956 , vol. 21, p. 1473,1474 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (1-METHYL-1-PROPOXYETHYL)BENZENE |
| (1-Methyl-1-p-tolyl-aethyl)-bernsteinsaeure |
| (1-methyl-1-p-tolyl-ethyl)-succinic acid |
| (1-methyl-1-phenyl-ethyl)-propyl ether |
| (1-Methyl-1-phenyl-aethyl)-propyl-aether |
| propyl cumyl ether |
| Benzene,(1-methyl-1-propoxyethyl) |