ethyl 4-sulfamoylbenzoate structure
|
Common Name | ethyl 4-sulfamoylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 5446-77-5 | Molecular Weight | 229.25300 | |
| Density | 1.326g/cm3 | Boiling Point | 396.4ºC at 760 mmHg | |
| Molecular Formula | C9H11NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | ethyl 4-sulfamoylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.326g/cm3 |
|---|---|
| Boiling Point | 396.4ºC at 760 mmHg |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.25300 |
| Flash Point | 193.6ºC |
| Exact Mass | 229.04100 |
| PSA | 94.84000 |
| LogP | 2.29180 |
| Index of Refraction | 1.548 |
| InChIKey | DFTXGSKTFDBVQM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(S(N)(=O)=O)cc1 |
| HS Code | 2935009090 |
|---|
|
~97%
ethyl 4-sulfamo... CAS#:5446-77-5 |
| Literature: Caturla, Francisco; Jimenez, Juan-Miguel; Godessart, Nuria; Amat, Merce; Cardenas, Alvaro; Soca, Lidia; Beleta, Jordi; Ryder, Hamish; Crespo, Maria I. Journal of Medicinal Chemistry, 2004 , vol. 47, # 15 p. 3874 - 3886 |
|
~%
ethyl 4-sulfamo... CAS#:5446-77-5 |
| Literature: A. H. Robins Company, Incorporated Patent: US4990523 A1, 1991 ; |
|
~%
ethyl 4-sulfamo... CAS#:5446-77-5 |
| Literature: Remsen Justus Liebigs Annalen der Chemie, 1875 , vol. 178, p. 284 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: Binding affinity against human carbonic anhydrase (hCA).
Source: ChEMBL
Target: Carbonic anhydrase 3
External Id: CHEMBL662691
|
|
Name: Binding constant against human Carbonic anhydrase II
Source: ChEMBL
Target: Carbonic anhydrase 2
External Id: CHEMBL828405
|
| 4-Sulfamoyl-benzoesaeure-aethylester |
| Ethyl p-sulfamylbenzoate |
| 4-sulfamoyl-benzoic acid ethyl ester |
| ethyl 4-sulfonamidobenzoate |
| p-Sulfamylbenzoesaeureaethylester |