Cyclooctaneacetic acid,1-hydroxy-a-phenyl- structure
|
Common Name | Cyclooctaneacetic acid,1-hydroxy-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5449-37-6 | Molecular Weight | 262.34400 | |
| Density | 1.152g/cm3 | Boiling Point | 425.5ºC at 760mmHg | |
| Molecular Formula | C16H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.3ºC | |
| Name | 2-(1-hydroxycyclooctyl)-2-phenylacetic acid |
|---|
| Density | 1.152g/cm3 |
|---|---|
| Boiling Point | 425.5ºC at 760mmHg |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.34400 |
| Flash Point | 225.3ºC |
| Exact Mass | 262.15700 |
| PSA | 57.53000 |
| LogP | 3.33020 |
| Index of Refraction | 1.561 |
| InChIKey | DLAJFOAZEIHIHR-UHFFFAOYSA-N |
| SMILES | O=C(O)C(c1ccccc1)C1(O)CCCCCCC1 |
|
~%
Cyclooctaneacet... CAS#:5449-37-6 |
| Literature: Blicke, Cox Journal of the American Chemical Society, 1955 , vol. 77, p. 5401 |
|
~%
Cyclooctaneacet... CAS#:5449-37-6 |
| Literature: Toullec, Jean; Mladenova, Margarita; Gaudemar-Bardone, Francoise; Blagoev, Blagoi Journal of Organic Chemistry, 1985 , vol. 50, # 14 p. 2563 - 2569 |
|
~%
Cyclooctaneacet... CAS#:5449-37-6 |
| Literature: Blicke, Arbor Patent: US2922795 , 1960 ; Chem.Abstr., 1960 , vol. 54, # 19453 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |