3-Amino-3-(3,4-dimethoxy-phenyl)-propionic acid methyl ester hydrochloride structure
|
Common Name | 3-Amino-3-(3,4-dimethoxy-phenyl)-propionic acid methyl ester hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 54503-20-7 | Molecular Weight | 275.72900 | |
| Density | N/A | Boiling Point | 359ºC at 760 mmHg | |
| Molecular Formula | C12H18ClNO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 153.2ºC | |
| Name | 3-Amino-3-(3,4-dimethoxy-phenyl)-propionic acid methyl ester hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 359ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H18ClNO4 |
| Molecular Weight | 275.72900 |
| Flash Point | 153.2ºC |
| Exact Mass | 275.09200 |
| PSA | 70.78000 |
| LogP | 2.76900 |
| InChIKey | DPDHEFCLHFWWJB-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(N)c1ccc(OC)c(OC)c1 |
| HS Code | 2922509090 |
|---|
|
~87%
3-Amino-3-(3,4-... CAS#:54503-20-7 |
| Literature: Mbatia, Hannah W.; Dhammika Bandara; Burdette, Shawn C. Chemical Communications, 2012 , vol. 48, # 43 p. 5331 - 5333 |
|
~81%
3-Amino-3-(3,4-... CAS#:54503-20-7 |
| Literature: Celgene Corporation Patent: US5703098 A1, 1997 ; |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenepropanoic acid,b-aMino-3,4-diMethoxy-,Methyl ester |
| methyl 3-amino-3-(3',4'-dimethoxyphenyl)propionate |
| methyl 3-amino-3-(3,4-dimethoxyphenyl)propanoate |