3-Amino-3-(3,4-dimethoxyphenyl)propanoic acid structure
|
Common Name | 3-Amino-3-(3,4-dimethoxyphenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 34840-85-2 | Molecular Weight | 225.241 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 379.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H15NO4 | Melting Point | 223ºC (dec.)(lit.) | |
| MSDS | N/A | Flash Point | 183.4±27.9 °C | |
| Name | 3-amino-3-(3,4-dimethoxy-phenyl)-propionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 379.7±42.0 °C at 760 mmHg |
| Melting Point | 223ºC (dec.)(lit.) |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.241 |
| Flash Point | 183.4±27.9 °C |
| Exact Mass | 225.100113 |
| PSA | 81.78000 |
| LogP | 0.65 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | FGCXSFRGPCUBPW-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(N)CC(=O)O)cc1OC |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Safety Phrases | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2922509090 |
|
~78%
3-Amino-3-(3,4-... CAS#:34840-85-2 |
| Literature: Bea, Han-Seop; Park, Hye-Jeong; Lee, Sang-Hyeup; Yun, Hyungdon Chemical Communications, 2011 , vol. 47, # 20 p. 5894 - 5896 |
|
~55%
3-Amino-3-(3,4-... CAS#:34840-85-2 |
| Literature: Celgene Corporation Patent: US5703098 A1, 1997 ; |
|
~57%
3-Amino-3-(3,4-... CAS#:34840-85-2 |
| Literature: CELGENE CORPORATION Patent: WO2004/45597 A1, 2004 ; Location in patent: Page/Page column 31-32; 38 ; |
|
~34%
3-Amino-3-(3,4-... CAS#:34840-85-2 |
| Literature: Russian Journal of General Chemistry, , vol. 75, # 7 p. 1113 - 1124 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenepropanoic acid, β-amino-3,4-dimethoxy- |
| 3-Amino-3-(3,4-dimethoxyphenyl)propanoic acid |
| rarechem ak hc t328 |
| MFCD00735172 |