Benzoic acid,4-methoxy-, heptyl ester structure
|
Common Name | Benzoic acid,4-methoxy-, heptyl ester | ||
|---|---|---|---|---|
| CAS Number | 5452-08-4 | Molecular Weight | 250.33300 | |
| Density | 0.999g/cm3 | Boiling Point | 347.3ºC at 760mmHg | |
| Molecular Formula | C15H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.3ºC | |
| Name | heptyl 4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.999g/cm3 |
|---|---|
| Boiling Point | 347.3ºC at 760mmHg |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.33300 |
| Flash Point | 144.3ºC |
| Exact Mass | 250.15700 |
| PSA | 35.53000 |
| LogP | 3.82240 |
| Index of Refraction | 1.49 |
| InChIKey | OEYMSYGFUQPUKZ-UHFFFAOYSA-N |
| SMILES | CCCCCCCOC(=O)c1ccc(OC)cc1 |
| HS Code | 2918990090 |
|---|
|
~37%
Benzoic acid,4-... CAS#:5452-08-4 |
| Literature: Giunta, Daniela; Masia, Maria Paola; Marchetti, Mauro; Morrone, Raffaele; Solinas, Maurizio Tetrahedron Letters, 2013 , vol. 54, # 37 p. 5122 - 5125 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,4-methoxy-,heptyl ester |
| 4-methoxy-benzoic acid heptyl ester |
| 4-Methoxy-benzoesaeure-heptylester |
| p-Methoxybenzoic acid,heptyl ester |
| n-Heptyl-4-methoxybenzoat |