N-(4-chlorophenyl)-2-nitro-fluoren-9-imine
Modify Date: 2025-08-28 18:14:09
N-(4-chlorophenyl)-2-nitro-fluoren-9-imine structure
|
Common Name | N-(4-chlorophenyl)-2-nitro-fluoren-9-imine | ||
|---|---|---|---|---|
| CAS Number | 5455-03-8 | Molecular Weight | 334.75600 | |
| Density | 1.37g/cm3 | Boiling Point | 505ºC at 760 mmHg | |
| Molecular Formula | C19H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.2ºC | |
| Name | (E)-N-(4-chlorophenyl)-2-nitro-9H-fluoren-9-imine |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 505ºC at 760 mmHg |
| Molecular Formula | C19H11ClN2O2 |
| Molecular Weight | 334.75600 |
| Flash Point | 259.2ºC |
| Exact Mass | 334.05100 |
| PSA | 58.18000 |
| LogP | 5.92090 |
| Index of Refraction | 1.69 |
| InChIKey | GKAFZNCHCNMDBB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(=Nc1ccc(Cl)cc1)c1ccccc1-2 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |