N-(4-methoxyphenyl)-2-nitro-fluoren-9-imine
Modify Date: 2025-09-08 09:51:37
N-(4-methoxyphenyl)-2-nitro-fluoren-9-imine structure
|
Common Name | N-(4-methoxyphenyl)-2-nitro-fluoren-9-imine | ||
|---|---|---|---|---|
| CAS Number | 5455-01-6 | Molecular Weight | 330.33700 | |
| Density | 1.28g/cm3 | Boiling Point | 513.6ºC at 760 mmHg | |
| Molecular Formula | C20H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.4ºC | |
| Name | N-(2-nitro-fluoranthen-3-yl)-acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 513.6ºC at 760 mmHg |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.33700 |
| Flash Point | 264.4ºC |
| Exact Mass | 330.10000 |
| PSA | 67.41000 |
| LogP | 5.27610 |
| Index of Refraction | 1.659 |
| InChIKey | JLDIEUXAGMIJGY-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=C2c3ccccc3-c3ccc([N+](=O)[O-])cc32)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Acetamide,N-(2-nitro-3-fluoranthenyl) |
| N-(2-Nitro-fluorenyliden)-p-anisidin |