Benzenamine,4-methoxy-N-[(4-nitrophenyl)methylene]
Modify Date: 2026-07-01 06:28:29
![Benzenamine,4-methoxy-N-[(4-nitrophenyl)methylene] Structure](https://image.chemsrc.com/caspic/064/5455-87-8.png)
Benzenamine,4-methoxy-N-[(4-nitrophenyl)methylene] structure
|
Common Name | Benzenamine,4-methoxy-N-[(4-nitrophenyl)methylene] | ||
|---|---|---|---|---|
| CAS Number | 5455-87-8 | Molecular Weight | 256.25700 | |
| Density | 1.18g/cm3 | Boiling Point | 432.1ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.1ºC | |
| Name | N-(4-methoxyphenyl)-1-(4-nitrophenyl)methanimine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 432.1ºC at 760 mmHg |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.25700 |
| Flash Point | 215.1ºC |
| Exact Mass | 256.08500 |
| PSA | 67.41000 |
| LogP | 3.87720 |
| Index of Refraction | 1.577 |
| InChIKey | PCMMEMLVVTUFTM-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=Cc2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2925290090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 5 | |
![N-[diphenoxyphosphoryl-(4-nitrophenyl)methyl]-4-methoxy-aniline structure](https://image.chemsrc.com/caspic/072/19348-92-6.png)
CAS#:19348-92-6
CAS#:501-58-6
CAS#:3156-41-0
CAS#:24393-61-1| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| 4-methoxy-4'-methylbenzanilide |
| 4-Methoxy-N-p-tolyl-benzamide |