2,4-Dinitrobenzaldehyde structure
|
Common Name | 2,4-Dinitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 528-75-6 | Molecular Weight | 196.11700 | |
| Density | 1.571 g/cm3 | Boiling Point | 190 °C10 mm Hg(lit.) | |
| Molecular Formula | C7H4N2O5 | Melting Point | 66-70 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 190°C/10mm | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,4-Dinitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.571 g/cm3 |
|---|---|
| Boiling Point | 190 °C10 mm Hg(lit.) |
| Melting Point | 66-70 °C(lit.) |
| Molecular Formula | C7H4N2O5 |
| Molecular Weight | 196.11700 |
| Flash Point | 190°C/10mm |
| Exact Mass | 196.01200 |
| PSA | 108.71000 |
| LogP | 2.36190 |
| Index of Refraction | 1.66 |
| InChIKey | ZILXIZUBLXVYPI-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | CU5957000 |
| HS Code | 2913000090 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|
Comparison of mutagenicity and theoretical reactivity of 2,4-dinitrobenzaldehyde and 2,6-dinitrobenzaldehyde in bacterial mutation assay and molecular orbital method.
Mutat. Res. 243(1) , 47-52, (1990) The mutagenicities and theoretical reactivity indices of 2,4-dinitrobenzaldehyde (2,4-DNBAl) and 2,6-dinitrobenzaldehyde (2,6-DNBAl) were investigated using Salmonella typhimurium strains TA98, TA98NR... |
|
|
Metabolism of 2,4-dinitrotoluene, 2,4-dinitrobenzyl alcohol and 2,4-dinitrobenzaldehyde by rat liver microsomal and cytosol fractions.
Chem. Pharm. Bull. 35(4) , 1579-86, (1987)
|
|
|
Enterohepatic circulation of 2,4-dinitrobenzaldehyde, a mutagenic metabolite of 2,4-dinitrotoluene, in male Wistar rat.
Xenobiotica 19(1) , 83-92, (1989) 1. The major biliary metabolite of 2,4-dinitrotoluene (2,4-DNT) in male Wistar rat was 2,4-dinitrobenzyl alcohol glucuronide and the minor metabolites were 2,4-dinitrobenzyl alcohol, 2,4-dinitrobenzal... |
| 2,4-Dinitro-benzaldehyd |
| 2,4-nitrobenzaldehyde |
| Benzaldehyde,2,4-dinitro |
| 2,4-DIBROMO-3,5-DICHLOROPHENYL ISOTHIOCYANATE |
| EINECS 208-440-7 |
| o-dinitrobenzaldehyde |
| 2,4-dinitro-benzaldehyde |
| MFCD00013376 |