gamma-linolenoyl chloride structure
|
Common Name | gamma-linolenoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 54562-14-0 | Molecular Weight | 296.87500 | |
| Density | 0.942g/cm3 | Boiling Point | 382.86ºC at 760 mmHg | |
| Molecular Formula | C18H29ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.846ºC | |
| Name | octadeca-6,9,12-trienoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 0.942g/cm3 |
|---|---|
| Boiling Point | 382.86ºC at 760 mmHg |
| Molecular Formula | C18H29ClO |
| Molecular Weight | 296.87500 |
| Flash Point | 184.846ºC |
| Exact Mass | 296.19100 |
| PSA | 17.07000 |
| LogP | 6.34130 |
| Index of Refraction | 1.486 |
| InChIKey | MAAVGFJWXMUHAT-UHFFFAOYSA-N |
| SMILES | CCCCCC=CCC=CCC=CCCCCC(=O)Cl |
| Storage condition | Refrigerator |
| HS Code | 2916190090 |
|---|
|
~%
gamma-linolenoy... CAS#:54562-14-0 |
| Literature: Heslinga; Van Der Linde; Pabon; Van Dorp Recueil des Travaux Chimiques des Pays Bas, 1975 , vol. 94, # 12 p. 262 - 273 |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| octadeca-6c,9c,12c-trienoyl chloride |