Benzamide,3-amino-2,4,6-tribromo- structure
|
Common Name | Benzamide,3-amino-2,4,6-tribromo- | ||
|---|---|---|---|---|
| CAS Number | 5458-02-6 | Molecular Weight | 372.83900 | |
| Density | 2.345g/cm3 | Boiling Point | 309.1ºC at 760mmHg | |
| Molecular Formula | C7H5Br3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.7ºC | |
| Name | 3-amino-2,4,6-tribromobenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 2.345g/cm3 |
|---|---|
| Boiling Point | 309.1ºC at 760mmHg |
| Molecular Formula | C7H5Br3N2O |
| Molecular Weight | 372.83900 |
| Flash Point | 140.7ºC |
| Exact Mass | 369.79500 |
| PSA | 69.11000 |
| LogP | 3.93670 |
| Index of Refraction | 1.715 |
| InChIKey | WJSJVUQNKVNLBT-UHFFFAOYSA-N |
| SMILES | NC(=O)c1c(Br)cc(Br)c(N)c1Br |
| HS Code | 2924299090 |
|---|
|
~%
Benzamide,3-ami... CAS#:5458-02-6 |
| Literature: Blanksma; Petri Recueil des Travaux Chimiques des Pays-Bas, 1947 , vol. 66, p. 369 Chem.Abstr., 1948 , vol. 42, p. 148 |
|
~%
Benzamide,3-ami... CAS#:5458-02-6 |
| Literature: Blanksma; Petri Recueil des Travaux Chimiques des Pays-Bas, 1947 , vol. 66, p. 369 Chem.Abstr., 1948 , vol. 42, p. 148 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Amino-2,4,6-tribrom-benzoesaeure-amid |
| 2.4.6-Tribrom-3-amino-benzamid |
| Benzamide,3-amino-2,4,6-tribromo |
| 3-amino-2,4,6-tribromo-benzoic acid amide |