2-Nitrophenylpyruvic acid structure
|
Common Name | 2-Nitrophenylpyruvic acid | ||
|---|---|---|---|---|
| CAS Number | 5461-32-5 | Molecular Weight | 209.156 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 379.7±25.0 °C at 760 mmHg | |
| Molecular Formula | C9H7NO5 | Melting Point | 119-120 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 168.6±11.6 °C | |
| Name | 2-Nitrophenylpyruvic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 379.7±25.0 °C at 760 mmHg |
| Melting Point | 119-120 °C(lit.) |
| Molecular Formula | C9H7NO5 |
| Molecular Weight | 209.156 |
| Flash Point | 168.6±11.6 °C |
| Exact Mass | 209.032425 |
| PSA | 100.19000 |
| LogP | 0.27 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | CGCWRLDEYHZQCW-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)Cc1ccccc1[N+](=O)[O-] |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Pyruvic acid, (o-nitrophenyl)- |
| EINECS 226-746-9 |
| MFCD00007191 |
| 3-(2-Nitrophenyl)-2-oxopropanoic acid |
| Benzenepropanoic acid, 2-nitro-α-oxo- |
| 2-Nitrophenylpyruvic acid |