2-Pyrrolidinone,1-(3-chlorophenyl)-3-[(3-chlorophenyl)imino]-5-(4-methoxyphenyl)- structure
|
Common Name | 2-Pyrrolidinone,1-(3-chlorophenyl)-3-[(3-chlorophenyl)imino]-5-(4-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5462-65-7 | Molecular Weight | 425.30700 | |
| Density | 1.3g/cm3 | Boiling Point | 586.7ºC at 760 mmHg | |
| Molecular Formula | C23H18Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.6ºC | |
| Name | 1-(3-chlorophenyl)-3-(3-chlorophenyl)imino-5-(4-methoxyphenyl)pyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 586.7ºC at 760 mmHg |
| Molecular Formula | C23H18Cl2N2O2 |
| Molecular Weight | 425.30700 |
| Flash Point | 308.6ºC |
| Exact Mass | 424.07500 |
| PSA | 41.90000 |
| LogP | 6.31770 |
| Index of Refraction | 1.635 |
| InChIKey | SPBGJDSPDBEMTN-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2CC(=Nc3cccc(Cl)c3)C(=O)N2c2cccc(Cl)c2)cc1 |
|
~%
Detail
|
| Literature: Lutz et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1810 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-(3-Chlor-phenyl)-3-(3-chlor-phenylimino)-5-(4-methoxy-phenyl)-pyrrolidin-2-on |
| 1-(3-chloro-phenyl)-3-(3-chloro-phenylimino)-5-(4-methoxy-phenyl)-pyrrolidin-2-one |