DL-N-Acetaminocinnamic Acid structure
|
Common Name | DL-N-Acetaminocinnamic Acid | ||
|---|---|---|---|---|
| CAS Number | 5469-45-4 | Molecular Weight | 205.210 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 455.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H11NO3 | Melting Point | 188-190 °C(lit.) | |
| MSDS | USA | Flash Point | 229.2±28.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(Acetylamino)-3-phenyl-2-propenoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 455.4±45.0 °C at 760 mmHg |
| Melting Point | 188-190 °C(lit.) |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.210 |
| Flash Point | 229.2±28.7 °C |
| Exact Mass | 205.073898 |
| PSA | 66.40000 |
| LogP | 1.88 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | XODAOBAZOQSFDS-JXMROGBWSA-N |
| SMILES | CC(=O)NC(=Cc1ccccc1)C(=O)O |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Enantioselective chemo- and bio-catalysis in ionic liquids.
Chem. Commun. (Camb.) 9 , 1033-43, (2004) Recent developments in the enantioselective chemo- and bio-catalysis in ionic liquids are reviewed. In many cases, the use of ionic liquids provides many advantages over reactions in conventional orga... |
|
|
Asymmetric hydrogenation of a-acetamidocinnamic acid with chiral rhodium complexes of DIOP and BPPM on charcoal. Masami I, et al.
Chem. Pharm. Bull. 31(10) , 3371-76, (1983)
|
| Alpha-Acetamidocinnamic Acid |
| 2-ACETAMIDO-CINNAMIC ACID |
| (Z)-2-(acetylamino)-3-phenylprop-2-enoic acid |
| DL-N-Acetaminocinnamic Acid |
| A-ACETAMIDOCINNAMIC ACID |
| (E)-2-acetamino-3-phenylpropenoic acid |
| AC-DHP-OH |
| ACETAMIDOCINNAMIC ACID |
| A-ACETAMINOCINNAMIC ACID |
| AC-2,3-DEHYDRO-PHE-OH |
| 2-Propenoic acid, 2-(acetylamino)-3-phenyl-, (2Z)- |
| MFCD00008680 |
| AC-DHA(2-PHE)-OH |
| 2-(Acetylamino)-3-phenyl-2-propenoic acid |
| N-acetyl dehydrophenylalanine |
| EINECS 226-795-6 |
| (2Z)-2-Acetamido-3-phenylacrylic acid |
| Z-N-acetyl-a-aminocinnamic acid |