3-Bromo-2-chloro-5-nitropyridine structure
|
Common Name | 3-Bromo-2-chloro-5-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 5470-17-7 | Molecular Weight | 237.439 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 293.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C5H2BrClN2O2 | Melting Point | 54-58ºC | |
| MSDS | USA | Flash Point | 131.5±25.9 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 3-Bromo-2-chloro-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 293.8±35.0 °C at 760 mmHg |
| Melting Point | 54-58ºC |
| Molecular Formula | C5H2BrClN2O2 |
| Molecular Weight | 237.439 |
| Flash Point | 131.5±25.9 °C |
| Exact Mass | 235.898804 |
| PSA | 58.71000 |
| LogP | 2.03 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | PTTQIUHVDDBART-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cnc(Cl)c(Br)c1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H318 |
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 25-41 |
| Safety Phrases | 26-39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933399090 |
|
~93%
3-Bromo-2-chlor... CAS#:5470-17-7 |
| Literature: Synthesis, , # 6 p. 499 - 501 |
| Precursor 1 | |
|---|---|
| DownStream 8 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Bromo-2-chloro-5-nitropyridine |
| Pyridine, 3-bromo-2-chloro-5-nitro- |
| MFCD00233989 |
| 3-Bromo-2-chloro-5-nitro-pyridine |