3-Bromo-2-methyl-5-nitropyridine structure
|
Common Name | 3-Bromo-2-methyl-5-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 186593-42-0 | Molecular Weight | 217.020 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 270.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H5BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.4±25.9 °C | |
| Name | 3-Bromo-2-methyl-5-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 270.6±35.0 °C at 760 mmHg |
| Molecular Formula | C6H5BrN2O2 |
| Molecular Weight | 217.020 |
| Flash Point | 117.4±25.9 °C |
| Exact Mass | 215.953430 |
| PSA | 58.71000 |
| LogP | 1.85 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | QWAOQTGMEGSRLN-UHFFFAOYSA-N |
| SMILES | Cc1ncc([N+](=O)[O-])cc1Br |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~80%
3-Bromo-2-methy... CAS#:186593-42-0 |
| Literature: H. Lundbeck A/S Patent: US2006/79524 A1, 2006 ; Location in patent: Page/Page column 13 ; US 20060079524 A1 |
|
~%
Detail
|
| Literature: US6133253 A1, ; |
|
~72%
3-Bromo-2-methy... CAS#:186593-42-0 |
| Literature: Abbott Laboratories Patent: US6127386 A1, 2000 ; US 6127386 A |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Bromo-2-methyl-5-nitro-pyridine |
| Pyridine, 3-bromo-2-methyl-5-nitro- |
| 3-BROMO-5-NITRO-2-PICOLINE |
| 3-Bromo-2-methyl-5-nitropyridine |
| 3-nitro-5-bromo-6-methylpyridine |
| 2-methyl-3-bromo-5-nitropyridine |
| 3-bromo-5-nitro-2-methylpyridine |