2-(4-phenoxyphenyl)propan-2-amine
Modify Date: 2025-08-27 11:39:43
2-(4-phenoxyphenyl)propan-2-amine structure
|
Common Name | 2-(4-phenoxyphenyl)propan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 54737-66-5 | Molecular Weight | 227.30200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-phenoxyphenyl)propan-2-amine |
|---|
| Molecular Formula | C15H17NO |
|---|---|
| Molecular Weight | 227.30200 |
| Exact Mass | 227.13100 |
| PSA | 35.25000 |
| LogP | 4.37300 |
| InChIKey | YLAODKGKGJCBKP-UHFFFAOYSA-N |
| SMILES | CC(C)(N)c1ccc(Oc2ccccc2)cc1 |
| HS Code | 2922299090 |
|---|
|
~%
2-(4-phenoxyphe... CAS#:54737-66-5 |
| Literature: Remy; van Saun Jr.; Engelhardt Journal of Medicinal Chemistry, 1975 , vol. 18, # 2 p. 142 - 148 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |