2-(difluoromethoxy)-5-nitroaniline structure
|
Common Name | 2-(difluoromethoxy)-5-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 54939-58-1 | Molecular Weight | 204.13100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6F2N2O3 | Melting Point | 75-77ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(difluoromethoxy)-5-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 75-77ºC |
|---|---|
| Molecular Formula | C7H6F2N2O3 |
| Molecular Weight | 204.13100 |
| Exact Mass | 204.03500 |
| PSA | 81.07000 |
| LogP | 2.88280 |
| InChIKey | ZLWYRUPJFBLFJZ-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])ccc1OC(F)F |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 20/21/22 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2922199090 |
|
~%
2-(difluorometh... CAS#:54939-58-1 |
| Literature: Sov. Prog. Chem. (Engl. Transl.), , vol. 41, # 1 p. 61 - 66,57 - 61 |
|
~%
2-(difluorometh... CAS#:54939-58-1 |
| Literature: Sov. Prog. Chem. (Engl. Transl.), , vol. 41, # 1 p. 61 - 66,57 - 61 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Amino-4-nitrophenyldifluormethylether |