(S)-2-Amino-3-(3,4-Dimethoxy-Phenyl)-Propionic Acid structure
|
Common Name | (S)-2-Amino-3-(3,4-Dimethoxy-Phenyl)-Propionic Acid | ||
|---|---|---|---|---|
| CAS Number | 55-59-4 | Molecular Weight | 225.241 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 374.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H15NO4 | Melting Point | 254-257ºC(lit.) | |
| MSDS | N/A | Flash Point | 180.2±27.9 °C | |
| Name | 2-amino-3-(3,4-dimethoxyphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 374.3±42.0 °C at 760 mmHg |
| Melting Point | 254-257ºC(lit.) |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.241 |
| Flash Point | 180.2±27.9 °C |
| Exact Mass | 225.100113 |
| PSA | 81.78000 |
| LogP | 0.85 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | VWTFNYVAFGYEKI-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(N)C(=O)O)cc1OC |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| HS Code | 2922509090 |
|
~%
(S)-2-Amino-3-(... CAS#:55-59-4 |
| Literature: Journal of the American Chemical Society, , vol. 35, p. 1611 |
|
~%
(S)-2-Amino-3-(... CAS#:55-59-4 |
| Literature: Journal of Organic Chemistry, , vol. 21, p. 336,338 |
|
~%
(S)-2-Amino-3-(... CAS#:55-59-4 |
| Literature: Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, , vol. 219, p. 233,237 |
|
~%
(S)-2-Amino-3-(... CAS#:55-59-4 |
| Literature: Canadian Journal of Chemistry, , vol. 52, # 16 p. 2873 - 2879 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Methoxy-O-methyltyrosine |
| 4-DiMethoxyphenylalanine |
| L-3,4-DIMETHOXYPHENYLALANINE |
| 3,4-Dimethoxy-dl-phenylalanine |
| 2-azanyl-3-(3,4-dimethoxyphenyl)propanoic acid |
| L-(3-METHOXY4-METHYL)-TYROSINE |
| TYROSINE,3-METHOXY-O-METHYL |
| H-TYR(3-OME,4-ME)-OH |
| 3,4-dimethoxyphenylalanine |
| H-PHE(3,4-DIMETHOXY)-OH |
| 3,4-Dimethoxy-L-phenylalanine |
| O-Dimethyl dopa |
| (S)-3,4-DIMETHOXY-PHENYLALANINE |
| 3-(3,4-dimethoxyphenyl)-2-aminopropionic acid |
| H-3,4-DIMETHOXY-PHE-OH |
| MFCD01321274 |
| 3,4-Dimethoxy-phenylalanin |
| H-PHE[3,4-(OME) 2]-OH |