2,4,6-Trimethyl-2,4,6-trivinylcyclotrisilazane structure
|
Common Name | 2,4,6-Trimethyl-2,4,6-trivinylcyclotrisilazane | ||
|---|---|---|---|---|
| CAS Number | 5505-72-6 | Molecular Weight | 255.540 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 229.3±9.0 °C at 760 mmHg | |
| Molecular Formula | C9H21N3Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 92.5±18.7 °C | |
| Name | 2,4,6-Trimethyl-2,4,6-trivinylcyclotrisilazane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 229.3±9.0 °C at 760 mmHg |
| Molecular Formula | C9H21N3Si3 |
| Molecular Weight | 255.540 |
| Flash Point | 92.5±18.7 °C |
| Exact Mass | 255.104324 |
| PSA | 36.09000 |
| LogP | 2.14680 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.481 |
| InChIKey | RFSBGZWBVNPVNN-UHFFFAOYSA-N |
| SMILES | C=C[Si]1(C)N[Si](C)(C=C)N[Si](C)(C=C)N1 |
| Hazard Codes | C |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3267 8/PG 3 |
| WGK Germany | 3 |
| HS Code | 2901299090 |
|
~%
2,4,6-Trimethyl... CAS#:5505-72-6 |
| Literature: Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), , p. 860 - 862 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, , p. 948 - 950 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2901299090 |
|---|---|
| Summary | 2901299090 unsaturated acyclic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
| 2,4,6-Trimethyl-2,4,6-trivinyl-1,3,5,2,4,6-triazatrisilinane |
| Cyclotrisilazane, 2,4,6-triethenyl-2,4,6-trimethyl- |
| 2,4,6-tris(ethenyl)-2,4,6-trimethyl-1,3,5,2,4,6-triazatrisilinane |