Ethyl 2-(1H-indol-3-yl)acetate structure
|
Common Name | Ethyl 2-(1H-indol-3-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 778-82-5 | Molecular Weight | 203.237 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 353.4±17.0 °C at 760 mmHg | |
| Molecular Formula | C12H13NO2 | Melting Point | 44-45 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 167.5±20.9 °C | |
| Name | Ethyl 3-indoleacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 353.4±17.0 °C at 760 mmHg |
| Melting Point | 44-45 °C(lit.) |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.237 |
| Flash Point | 167.5±20.9 °C |
| Exact Mass | 203.094635 |
| PSA | 42.09000 |
| LogP | 2.42 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | HUDBDWIQSIGUDI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1c[nH]c2ccccc12 |
| Storage condition | -20°C |
| Water Solubility | insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R21/22;R36/37/38 |
| Safety Phrases | S36/37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | NL3528000 |
| HS Code | 2933990090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Generation of electronically excited triplet species at the cellular level: a potential source of genotoxicity.
Toxicol. Lett. 67(1-3) , 17-28, (1993) Selected enzymatic systems can efficiently produce a product in the electronically excited triplet state. Earlier, only the formation of electronically excited singlet species was known. The formation... |
|
|
Mutants of Nicotiana plumbaginifolia with specific resistance to auxin.
Mol. Gen. Genet. 228(3) , 361-71, (1991) We have isolated nine independent auxin-resistant mutants of Nicotiana plumbaginifolia by culturing M2 seedlings in the presence of indole-3-acetic acid ethyl ester or 1-naphthaleneacetic acid at conc... |
| Ethyl 1H-indol-3-ylacetate |
| ethyl 2-(1H-indol-3-yl)acetate |
| MFCD00005635 |
| ethyl indole-3-acetate |
| 1H-Indole-3-acetic acid, ethyl ester |
| EINECS 212-296-0 |