DL-071-IT structure
|
Common Name | DL-071-IT | ||
|---|---|---|---|---|
| CAS Number | 55104-39-7 | Molecular Weight | 315.79 | |
| Density | N/A | Boiling Point | 485.4ºC at 760 mmHg | |
| Molecular Formula | C15H22ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.3ºC | |
Use of DL-071-ITDL 071IT is a potent non-selective beta-adrenergic receptor blocker. DL 071IT exhibits intrinsic sympathomimetic activity and weak membrane stabilizing activity. DL 071IT reduces exercise heart rate and systolic blood pressure, and even significantly lowers resting heart rate[1]. |
| Name | 7-[3-(tert-butylamino)-2-hydroxypropoxy]-3H-2-benzofuran-1-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | DL 071IT is a potent non-selective beta-adrenergic receptor blocker. DL 071IT exhibits intrinsic sympathomimetic activity and weak membrane stabilizing activity. DL 071IT reduces exercise heart rate and systolic blood pressure, and even significantly lowers resting heart rate[1]. |
|---|---|
| Related Catalog | |
| Target |
β adrenergic receptor |
| References |
| Boiling Point | 485.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C15H22ClNO4 |
| Molecular Weight | 315.79 |
| Flash Point | 247.3ºC |
| Exact Mass | 315.12400 |
| PSA | 67.79000 |
| LogP | 2.67770 |
| InChIKey | KTIQCDLYPPAYBF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(O)COc1cccc2c1C(=O)OC2.Cl |
| Storage condition | -20℃ |
| 1(3H)-Isobenzofuranone,7-(3-((1,1-dimethylethyl)amino)-2-hydroxypropoxy)-,hydrochloride |
| DL 071 IT |
| DL-071-IT |