Choline tosylate structure
|
Common Name | Choline tosylate | ||
|---|---|---|---|---|
| CAS Number | 55357-38-5 | Molecular Weight | 275.36400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21NO4S | Melting Point | 95°C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Hydroxy-N,N,N-trimethylethanaminium 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 95°C |
|---|---|
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.36400 |
| Exact Mass | 275.11900 |
| PSA | 85.81000 |
| LogP | 1.66480 |
| InChIKey | DVGVMQVOCJNXNJ-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CCO.Cc1ccc(S(=O)(=O)[O-])cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2923900090 |
|
~99%
Choline tosylate CAS#:55357-38-5 |
| Literature: Klykov; Serebrennikova Russian Chemical Bulletin, 1998 , vol. 47, # 8 p. 1547 - 1549 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Brockerhoff, H. and Ayengar, N.K.N.,
Lipids 14 , 88, (1979)
|
| Choline tosylate |
| MFCD00079051 |