Acetic 2-(phenoxymethyl)benzoic anhydride structure
|
Common Name | Acetic 2-(phenoxymethyl)benzoic anhydride | ||
|---|---|---|---|---|
| CAS Number | 55453-89-9 | Molecular Weight | 286.28 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 435.8±37.0 °C at 760 mmHg | |
| Molecular Formula | C16H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.4±26.5 °C | |
| Name | 2-((4-(Carboxymethyl)phenoxy)methyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 435.8±37.0 °C at 760 mmHg |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.28 |
| Flash Point | 194.4±26.5 °C |
| Exact Mass | 286.08412354 |
| PSA | 52.60000 |
| LogP | 2.84 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | BCYWXPITXHFIQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CC=C(C=C2)CC(=O)O)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[[4-(carboxymethyl)phenoxy]methyl]benzoic acid |
| Acetic 2-(phenoxymethyl)benzoic anhydride |