Nepetoidin B structure
|
Common Name | Nepetoidin B | ||
|---|---|---|---|---|
| CAS Number | 55486-06-1 | Molecular Weight | 314.29 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 587.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.4±23.6 °C | |
Use of Nepetoidin BNepetoidin B, an anti-inflammatory agent, inhibits inflammation by modulating the NF-κB and Nrf2/HO-1 signaling pathways. Nepetoidin B also has antifungal and antibacterial activity. Nepetoidin B is a natural product that can be obtained from Salvia plebeia R. Br. Nepetoidin B can be used in anti-inflammatory and anti-infectious research[1][2]. |
| Name | Nepetoidin B |
|---|---|
| Synonym | More Synonyms |
| Description | Nepetoidin B, an anti-inflammatory agent, inhibits inflammation by modulating the NF-κB and Nrf2/HO-1 signaling pathways. Nepetoidin B also has antifungal and antibacterial activity. Nepetoidin B is a natural product that can be obtained from Salvia plebeia R. Br. Nepetoidin B can be used in anti-inflammatory and anti-infectious research[1][2]. |
|---|---|
| Related Catalog | |
| Target |
NF-κB, bacterial, fungal[1][2]. |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 587.4±50.0 °C at 760 mmHg |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 |
| Flash Point | 219.4±23.6 °C |
| Exact Mass | 314.079041 |
| LogP | 2.67 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.752 |
| InChIKey | GFZFUVWXGQWUGX-DGEKEWMVSA-N |
| SMILES | O=C(C=Cc1ccc(O)c(O)c1)OC=Cc1ccc(O)c(O)c1 |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|
| (Z)-2-(3,4-Dihydroxyphenyl)vinyl (2E)-3-(3,4-dihydroxyphenyl)acrylate |
| 2-Propenoic acid, 3-(3,4-dihydroxyphenyl)-, (Z)-2-(3,4-dihydroxyphenyl)ethenyl ester, (2E)- |