Permethric acid structure
|
Common Name | Permethric acid | ||
|---|---|---|---|---|
| CAS Number | 55701-05-8 | Molecular Weight | 209.07000 | |
| Density | 1.433 g/cm3 | Boiling Point | 290.6ºC at 760 mmHg | |
| Molecular Formula | C8H10Cl2O2 | Melting Point | 58.33°C (lit.) | |
| MSDS | N/A | Flash Point | 129.6ºC | |
| Name | 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.433 g/cm3 |
|---|---|
| Boiling Point | 290.6ºC at 760 mmHg |
| Melting Point | 58.33°C (lit.) |
| Molecular Formula | C8H10Cl2O2 |
| Molecular Weight | 209.07000 |
| Flash Point | 129.6ºC |
| Exact Mass | 208.00600 |
| PSA | 37.30000 |
| LogP | 2.66220 |
| InChIKey | LLMLSUSAKZVFOA-UHFFFAOYSA-N |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916209090 |
| Precursor 8 | |
|---|---|
| DownStream 7 | |
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Permethric acid |
| 3-(2,2-Dichlorovinyl)-2,2-dimethyl(1-cyclopropane)carboxylic acid |