Cypermethrin structure
|
Common Name | Cypermethrin | ||
|---|---|---|---|---|
| CAS Number | 52315-07-8 | Molecular Weight | 416.297 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 511.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H19Cl2NO3 | Melting Point | 60-80°C | |
| MSDS | Chinese USA | Flash Point | 263.0±30.1 °C | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | cypermethrin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 511.3±50.0 °C at 760 mmHg |
| Melting Point | 60-80°C |
| Molecular Formula | C22H19Cl2NO3 |
| Molecular Weight | 416.297 |
| Flash Point | 263.0±30.1 °C |
| Exact Mass | 415.074188 |
| PSA | 59.32000 |
| LogP | 6.27 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | KAATUXNTWXVJKI-UHFFFAOYSA-N |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1 |
| Stability | Stable. Incompatible with bases, strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H317-H332-H335-H373-H410 |
| Precautionary Statements | Missing Phrase - N15.00950417-P260-P280 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn;N |
| Risk Phrases | R22;R37/38;R43;R50/53 |
| Safety Phrases | 24-36/37/39-60-61-2-36-26-16 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | GZ1250000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2926909031 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2926909031 |
|---|
|
Choline partially prevents the impact of ethanol on the lipid raft dependent functions of l1 cell adhesion molecule.
Alcohol. Clin. Exp. Res. 38(11) , 2722-30, (2014) Fetal alcohol spectrum disorder, the leading known cause of mental retardation, is caused by alcohol exposure during pregnancy. One mechanism of ethanol (EtOH) teratogenicity is the disruption of the ... |
|
|
Development of a multi-residue method in a fetal matrix: analysis of meconium.
Anal. Bioanal. Chem 406(30) , 7785-97, (2014) Meconium is the earliest stool of newborns. It is a complex matrix that reflects the degree of fetal exposure to environmental pollutants. To investigate exposure to xenobiotics, an analytical method ... |
|
|
Atmospheric pressure gas chromatography-time-of-flight-mass spectrometry (APGC-ToF-MS) for the determination of regulated and emerging contaminants in aqueous samples after stir bar sorptive extraction (SBSE).
Anal. Chim. Acta 851 , 1-13, (2014) This work presents the development, optimization and validation of a multi-residue method for the simultaneous determination of 102 contaminants, including fragrances, UV filters, repellents, endocrin... |
| Cyano(3-phenoxyphenyl)methyl 3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
| 3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropanecarboxylic acid cyano(3-phenoxyphenyl)methyl ester |
| Cnn52 |
| Cymperator |
| UNII:1TR49121NP |
| Alphamethrine |
| (RS)-α-Cyano-3-phenoxybenzyl (1RS)-cis,trans-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
| (RS)-α-cyano-3-phenoxybenzyl (1RS,3RS |
| (RS)-α-cyano-3-phenoxybenzyl (1RS)-cis-trans-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
| MFCD00055328 |
| Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methyl ester |
| Kefil Super |
| Cyclopropanecarboxylic acid, 3-(2,2-dichloroethenyl)-2,2-dimethyl-, cyano(3-phenoxyphenyl)methyl ester, (±)- |
| Cypermethrin |
| EINECS 257-842-9 |
| cypermethrin [ANSI] |
| 1RS,3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
| Cyano(3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
| (Ξ)-cyano(3-phenoxyphenyl)methyl (1Ξ,3Ξ)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxylate |