4-ethenyl-2-methoxy-1-phenylmethoxybenzene structure
|
Common Name | 4-ethenyl-2-methoxy-1-phenylmethoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 55708-65-1 | Molecular Weight | 240.29700 | |
| Density | 1.072g/cm3 | Boiling Point | 371.3ºC at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | 49-54ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Name | 4-ethenyl-2-methoxy-1-phenylmethoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.072g/cm3 |
|---|---|
| Boiling Point | 371.3ºC at 760 mmHg |
| Melting Point | 49-54ºC(lit.) |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | >230 °F |
| Exact Mass | 240.11500 |
| PSA | 18.46000 |
| LogP | 3.91720 |
| Index of Refraction | 1.584 |
| InChIKey | DPAUCHAAEWIRKG-UHFFFAOYSA-N |
| SMILES | C=Cc1ccc(OCc2ccccc2)c(OC)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| 4-Benzyloxy-3-methoxystyrene |
| EINECS 259-771-9 |
| 4-benzyloxy-3-methoxy-1-ethenylbenzene |
| MFCD00008616 |
| 2-Benzyloxy-5-vinylanisole |
| 1-benzyloxy-2-methoxy-4-vinylbenzene |
| 4-ethenyl-2-methoxy-1-benzyloxybenzene |