benzyl N-(4-sulfamoylphenyl)carbamate
Modify Date: 2025-09-09 23:15:39
benzyl N-(4-sulfamoylphenyl)carbamate structure
|
Common Name | benzyl N-(4-sulfamoylphenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 55871-46-0 | Molecular Weight | 306.33700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzyl N-(4-sulfamoylphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H14N2O4S |
|---|---|
| Molecular Weight | 306.33700 |
| Exact Mass | 306.06700 |
| PSA | 106.87000 |
| LogP | 3.93680 |
| InChIKey | MNZRGAXOOZDZIY-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)OCc2ccccc2)cc1 |
|
~96%
benzyl N-(4-sul... CAS#:55871-46-0 |
| Literature: RIB-X PHARMACEUTICALS, INC. Patent: WO2004/29066 A2, 2004 ; Location in patent: Page/Page column 264; 265 ; |
|
~%
benzyl N-(4-sul... CAS#:55871-46-0 |
| Literature: Gregory et al. Journal of the Chemical Society, 1949 , p. 2066,2069 |
![BENZYL [4-(CHLOROSULFONYL)PHENYL]CARBAMATE structure](https://image.chemsrc.com/caspic/398/54290-54-9.png)
CAS#:127-71-9
CAS#:144-80-9| p-Benzyloxycarbonylaminobenzolsulfonamid |
| N-benzyloxycarbonyl-sulfanilic acid amide |
| N-Benzyloxycarbonyl-sulfanilsaeure-amid |
| benzyl 4-sulfamoylphenylcarbamate |