5-(4-bromophenyl)-5-phenylimidazolidine-2,4-dione structure
|
Common Name | 5-(4-bromophenyl)-5-phenylimidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 56079-85-7 | Molecular Weight | 331.16400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H11BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(4-bromophenyl)-5-phenylimidazolidine-2,4-dione |
|---|
| Molecular Formula | C15H11BrN2O2 |
|---|---|
| Molecular Weight | 331.16400 |
| Exact Mass | 330.00000 |
| PSA | 65.18000 |
| LogP | 2.44800 |
| InChIKey | POMIFDDEWLQZOM-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(c2ccccc2)(c2ccc(Br)cc2)N1 |
|
~%
5-(4-bromopheny... CAS#:56079-85-7 |
| Literature: Parke, Davis and Co. Patent: US2409754 , 1940 ; |
|
~%
5-(4-bromopheny... CAS#:56079-85-7 |
| Literature: Hatt; Pilgrim; Hurran Journal of the Chemical Society, 1936 , p. 93 |
|
~%
5-(4-bromopheny... CAS#:56079-85-7 |
| Literature: Hatt; Pilgrim; Hurran Journal of the Chemical Society, 1936 , p. 93 |