2-Amino-6-(trifluoromethoxy)benzoic acid structure
|
Common Name | 2-Amino-6-(trifluoromethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 561304-48-1 | Molecular Weight | 221.133 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 289.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H6F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.8±27.3 °C | |
| Name | 2-Amino-6-(trifluoromethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 289.3±40.0 °C at 760 mmHg |
| Molecular Formula | C8H6F3NO3 |
| Molecular Weight | 221.133 |
| Flash Point | 128.8±27.3 °C |
| Exact Mass | 221.029984 |
| PSA | 72.55000 |
| LogP | 1.83 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | GPGNUJGCHLXOIW-UHFFFAOYSA-N |
| SMILES | Nc1cccc(OC(F)(F)F)c1C(=O)O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid, 2-amino-6-(trifluoromethoxy)- |
| WT2241 |
| 2-Amino-6-(trifluoromethoxy)benzoic acid |
| WT080 |
| 2-Amino-6-(trifluoromethoxy)-benzoic acid |