Tris(3-methylphenyl) phosphate structure
|
Common Name | Tris(3-methylphenyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 563-04-2 | Molecular Weight | 368.363 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 441.7±44.0 °C at 760 mmHg | |
| Molecular Formula | C21H21O4P | Melting Point | 25.5ºC | |
| MSDS | Chinese USA | Flash Point | 234.3±48.8 °C | |
| Name | tris(3-methylphenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.7±44.0 °C at 760 mmHg |
| Melting Point | 25.5ºC |
| Molecular Formula | C21H21O4P |
| Molecular Weight | 368.363 |
| Flash Point | 234.3±48.8 °C |
| Exact Mass | 368.117737 |
| PSA | 54.57000 |
| LogP | 5.48 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | RMLPZKRPSQVRAB-UHFFFAOYSA-N |
| SMILES | Cc1cccc(OP(=O)(Oc2cccc(C)c2)Oc2cccc(C)c2)c1 |
| Storage condition | 0-10°C |
| Hazard Codes | N: Dangerous for the environment;Xn: Harmful; |
|---|---|
| Risk Phrases | 51/53-21/22 |
| Safety Phrases | 61-28A |
| RIDADR | UN 3082 |
| Packaging Group | III |
| HS Code | 2919900090 |
|
~87%
Tris(3-methylph... CAS#:563-04-2 |
| Literature: Sagar; Shinde; Bandgar Organic Preparations and Procedures International, 2000 , vol. 32, # 3 p. 269 - 271 |
|
~91%
Tris(3-methylph... CAS#:563-04-2 |
| Literature: Sagar; Thorat; Salunkhe Synthetic Communications, 1994 , vol. 24, # 14 p. 2029 - 2033 |
|
~19%
Tris(3-methylph... CAS#:563-04-2 |
| Literature: Journal of Organic Chemistry, , vol. 51, # 2 p. 179 - 183 |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| TRI-M-CRESYL PHOSPHATE |
| Phosphoric acid,tri-m-tolyl ester |
| tri-meta-cresyl phosphate |
| m-tricresyl phosphate |
| Tri-m-cresyl phosphite |
| EINECS 209-241-8 |
| Tris(3-methylphenyl) phosphate |
| Tris(m-tolyl) phosphate |
| Phosphoric acid,tris(3-methylphenyl) ester |
| MFCD00041907 |
| Tris-m-cresyl phosphate |
| tri-m-tolyl phosphate |
| Phosphoric acid, tris(3-methylphenyl) ester |