6-Nitro-m-cresol structure
|
Common Name | 6-Nitro-m-cresol | ||
|---|---|---|---|---|
| CAS Number | 700-38-9 | Molecular Weight | 153.135 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 252.4±20.0 °C at 760 mmHg | |
| Molecular Formula | C7H7NO3 | Melting Point | 53-56 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 109.4±0.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Methyl-2-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 252.4±20.0 °C at 760 mmHg |
| Melting Point | 53-56 °C(lit.) |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | 153.135 |
| Flash Point | 109.4±0.0 °C |
| Exact Mass | 153.042587 |
| PSA | 66.05000 |
| LogP | 2.17 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | NQXUSSVLFOBRSE-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c(O)c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | 2446 |
| WGK Germany | 3 |
| RTECS | SM1130950 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 29089000 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Biodegradable injectable in situ implants and microparticles for sustained release of montelukast: in vitro release, pharmacokinetics, and stability.
AAPS PharmSciTech 15(3) , 772-80, (2014) The objective of this study was to investigate the sustained release of a hydrophilic drug, montelukast (MK), from two biodegradable polymeric drug delivery systems, in situ implant (ISI) and in situ ... |
|
|
Mutagenic activities of a chlorination by-product of butamifos, its structural isomer, and their related compounds.
Chemosphere 78(4) , 482-7, (2010) The mutagenic activities of 5-methyl-2-nitrophenol (5M2NP), a chlorination by-product of butamifos, its structural isomer 2-methyl-5-nitrophenol (2M5NP), and related compounds were evaluated by the Am... |
|
|
Separated and aligned molecular fibres in solid state self-assemblies of cyclodextrin [2]rotaxanes.
Chemistry 9(24) , 5971-7, (2003) The conformations of two [2]rotaxanes, each comprising alpha-cyclodextrin as the rotor, a stilbene as the axle and 2,4,6-trinitrophenyl substituents as the capping groups, have been examined in soluti... |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| m-Cresol,6-nitro |
| 3-Me-6-NO2-phenol |
| 2-hydroxy-4-methylnitrobenzene |
| 3-Methyl-6-nitrophenol |
| 2-Nitro-3-methylphenol |
| 5-Methyl-2-nitrophenol |
| EINECS 211-843-0 |
| 6-Nitro-m-cresol |
| 6-Nitro-3-cresol |
| 5-Methyl-2-nitrobenzolol |
| 5-Methyl-2-nitro-phenol |
| 3-Hydroxy-4-nitrotoluene |
| MFCD00007111 |
| 2-nitro-5-methylphenol |
| Phenol,5-methyl-2-nitro |