Tris(2,2,3,3-tetrafluoropropyl)phosphate structure
|
Common Name | Tris(2,2,3,3-tetrafluoropropyl)phosphate | ||
|---|---|---|---|---|
| CAS Number | 563-10-0 | Molecular Weight | 494.16600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15F12O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phosphoric acid,2,2,3,3-tetrafluoropropan-1-ol |
|---|
| Molecular Formula | C9H15F12O7P |
|---|---|
| Molecular Weight | 494.16600 |
| Exact Mass | 494.03600 |
| PSA | 148.26000 |
| LogP | 1.70870 |
| InChIKey | YZQXAGZTJRSUJT-UHFFFAOYSA-N |
| SMILES | O=P(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)OCC(F)(F)C(F)F |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |