rac 1-Oleoyl Glycerol-d5 structure
|
Common Name | rac 1-Oleoyl Glycerol-d5 | ||
|---|---|---|---|---|
| CAS Number | 565183-24-6 | Molecular Weight | 361.57 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 483.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C21H35D5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.4±19.4 °C | |
Use of rac 1-Oleoyl Glycerol-d5Monoolein-d5 is the deuterium labeled Monoolein. Monoolein is an endogenous metabolite. |
| Name | (1,1,2,3,3-pentadeuterio-2,3-dihydroxypropyl) (Z)-octadec-9-enoate |
|---|---|
| Synonym | More Synonyms |
| Description | Monoolein-d5 is the deuterium labeled Monoolein. Monoolein is an endogenous metabolite. |
|---|---|
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 483.3±35.0 °C at 760 mmHg |
| Molecular Formula | C21H35D5O4 |
| Molecular Weight | 361.57 |
| Flash Point | 155.4±19.4 °C |
| Exact Mass | 356.292664 |
| PSA | 66.76000 |
| LogP | 6.71 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | RZRNAYUHWVFMIP-FNKKQMTJSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(O)CO |
| 1-GLYCERYL OLEATE |
| Oleic monoglyceride |
| Rylo MG 19-d5 |
| 1-monooleoyl-rac-glycerol |
| 2,3-Dihydroxypropyl (9Z)-octadec-9-enoate |
| a-Monoolein |
| 1-Monooleoylglycerol |
| 1-Monoolein-d5 |
| Danisco MO 90 |
| Glycerin 1-monooleate |
| Glycerol 1-Oleate-d5 |
| Monoolein (VAN) |
| Glyceryl Monooleate (VAN) |
| 2,3-Dihydroxypropyl Oleate-d5 |
| Oleic acid glycerol monoester |
| rac 1-Oleoyl Glycerol-d5 |
| Glycerol |A-cis-9-Octadecenate-d5 |
| dl-α-Monoolein |
| Glycerol α-monooleate |
| UNII:D3AEF6S35P |
| 1-O-Oleyl-rac-glycerol |
| 1-oleoyl glycerol |
| Danisco MO 90-d5 |
| 1-OLEOYLGLYCEROL |
| α-Monoolein |
| rac-1-Monooleoylglycerol |
| Glyceryl Monooleate-d5 |
| Monoolein |
| OLEOYL GLYCEROL |
| 1-Mono(cis-9-octacenoyl)glycerol |
| 9-Octadecenoic acid, 2,3-dihydroxypropyl ester, (9Z)- |
| rac-1-Monooleoylglycerol-d5 |
| 2,3-Dihydroxypropyl (9Z)-9-octadecenoate |
| Aldo HMO |
| rac-1-Monoolein-d5 |
| 2,3-Dihydroxypropyl oleate |
| rac 1-Oleoyl Glycerol-d5 |