2,2,2-trichloroethyl 2-hydroxybenzoate
2,2,2-trichloroethyl 2-hydroxybenzoate structure
|
Common Name | 2,2,2-trichloroethyl 2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 56529-85-2 | Molecular Weight | 269.50900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7Cl3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2,2,2-Trichloroethyl 2-hydroxybenzoate (CAS: 56529-85-2, molecular formula: C9H7Cl3O3, molecular weight: 269.51) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,2-trichloroethyl 2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7Cl3O3 |
|---|---|
| Molecular Weight | 269.50900 |
| Exact Mass | 267.94600 |
| PSA | 46.53000 |
| LogP | 2.91920 |
| InChIKey | UELQWFGZUCGZPU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)OCC(Cl)(Cl)Cl)O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~57%
2,2,2-trichloro... CAS#:56529-85-2 |
| Literature: Scotia Holdings Plc Patent: US5603959 A1, 1997 ; |
|
~59%
2,2,2-trichloro... CAS#:56529-85-2 |
| Literature: Scotia Holdings PLC Patent: US5990164 A1, 1999 ; |
|
~76%
2,2,2-trichloro... CAS#:56529-85-2 |
| Literature: Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 8 p. 2632 - 2638 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzoic acid,2-hydroxy-,2,2,2-trichloroethyl ester |
| 2,2,2-trichloroethyl salicylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2,2,2-trichloroethyl 2-hydroxybenzoate? |
| A: SMILES notation of 2,2,2-trichloroethyl 2-hydroxybenzoate is C1=CC=C(C(=C1)C(=O)OCC(Cl)(Cl)Cl)O. |
| Q: What is the polar surface area (PSA) of 2,2,2-trichloroethyl 2-hydroxybenzoate? |
| A: Polar surface area (PSA) of 2,2,2-trichloroethyl 2-hydroxybenzoate is 46.53000. |
| Q: What is the LogP of 2,2,2-trichloroethyl 2-hydroxybenzoate? |
| A: LogP of 2,2,2-trichloroethyl 2-hydroxybenzoate is 2.91920. |
| Q: What is the English name of 2,2,2-trichloroethyl 2-hydroxybenzoate? |
| A: The English name of 2,2,2-trichloroethyl 2-hydroxybenzoate is 2,2,2-trichloroethyl 2-hydroxybenzoate. |
| Q: What are the upstream materials of 2,2,2-trichloroethyl 2-hydroxybenzoate? |
| A: Related upstream materials(CAS) of 2,2,2-trichloroethyl 2-hydroxybenzoate: 7664-93-9;69-72-7;115-20-8. |
| Q: What is the molecular formula of 2,2,2-trichloroethyl 2-hydroxybenzoate? |
| A: Molecular formula of 2,2,2-trichloroethyl 2-hydroxybenzoate is C9H7Cl3O3. |
| Q: What English synonyms does 2,2,2-trichloroethyl 2-hydroxybenzoate have? |
| A: English synonyms of 2,2,2-trichloroethyl 2-hydroxybenzoate: Benzoic acid,2-hydroxy-,2,2,2-trichloroethyl ester, 2,2,2-trichloroethyl salicylate. |
| Q: What is the molecular weight of 2,2,2-trichloroethyl 2-hydroxybenzoate? |
| A: Molecular weight of 2,2,2-trichloroethyl 2-hydroxybenzoate is 269.50900. |
| Q: What is the Chinese name of 56529-85-2? |
| A: Chinese name of 56529-85-2 is 56529-85-2. |
| Q: What is the InChIKey of 2,2,2-trichloroethyl 2-hydroxybenzoate? |
| A: InChIKey of 2,2,2-trichloroethyl 2-hydroxybenzoate is UELQWFGZUCGZPU-UHFFFAOYSA-N. |